EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16N2O2 |
| Net Charge | 0 |
| Average Mass | 196.250 |
| Monoisotopic Mass | 196.12118 |
| SMILES | NC1C=CC(CC[C@H](N)C(=O)O)C=C1 |
| InChI | InChI=1S/C10H16N2O2/c11-8-4-1-7(2-5-8)3-6-9(12)10(13)14/h1-2,4-5,7-9H,3,6,11-12H2,(H,13,14)/t7?,8?,9-/m0/s1 |
| InChIKey | LAJWZJCOWPUSOA-HACHORDNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (4436150) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Amiclenomycin (CHEBI:208148) is a L-α-amino acid (CHEBI:15705) |
| IUPAC Name |
|---|
| (2S)-2-amino-4-(4-aminocyclohexa-2,5-dien-1-yl)butanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 89978 | ChemSpider |