EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H10O2 |
| Net Charge | 0 |
| Average Mass | 210.232 |
| Monoisotopic Mass | 210.06808 |
| SMILES | Oc1c(O)c2ccccc2c2ccccc12 |
| InChI | InChI=1S/C14H10O2/c15-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14(13)16/h1-8,15-16H |
| InChIKey | ODUSUXJNDWKJKH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phenanthrene-9,10-diol (CHEBI:20814) is a phenanthrenediol (CHEBI:37453) |
| Incoming Relation(s) |
| 9,10-dihydrophenanthrene-9,10-diol (CHEBI:37469) has functional parent phenanthrene-9,10-diol (CHEBI:20814) |
| 9,10-phenanthrenediyl bissulfate (CHEBI:25956) has functional parent phenanthrene-9,10-diol (CHEBI:20814) |
| IUPAC Name |
|---|
| phenanthrene-9,10-diol |
| Synonyms | Source |
|---|---|
| 9,10-dihydroxyphenanthrene | UM-BBD |
| 9,10-phenanthrenediol | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| phenanthrene-9,10-diol | UniProt |