EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H20O6 |
| Net Charge | 0 |
| Average Mass | 392.407 |
| Monoisotopic Mass | 392.12599 |
| SMILES | COc1cc2c(c(O)c1Cc1ccccc1O)C(=O)C[C@@H](c1ccc(O)cc1)O2 |
| InChI | InChI=1S/C23H20O6/c1-28-20-12-21-22(23(27)16(20)10-14-4-2-3-5-17(14)25)18(26)11-19(29-21)13-6-8-15(24)9-7-13/h2-9,12,19,24-25,27H,10-11H2,1H3/t19-/m0/s1 |
| InChIKey | SCYWNQTZQMNLGR-IBGZPJMESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sanghuangporus baumii (ncbitaxon:108892) | - | PubMed (21531558) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Epi-methylphelligrin A (CHEBI:208076) is a diarylheptanoid (CHEBI:78802) |
| IUPAC Name |
|---|
| (2S)-5-hydroxy-2-(4-hydroxyphenyl)-6-[(2-hydroxyphenyl)methyl]-7-methoxy-2,3-dihydrochromen-4-one |
| Manual Xrefs | Databases |
|---|---|
| 26336896 | ChemSpider |