EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H23ClN4O7 |
| Net Charge | 0 |
| Average Mass | 466.878 |
| Monoisotopic Mass | 466.12553 |
| SMILES | C[C@@H](NC(=O)[C@@]1(C)COC(c2cn(C)c3cc(Cl)cc(O)c23)=N1)C(=O)N[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C20H23ClN4O7/c1-9(16(28)23-12(7-26)18(29)30)22-19(31)20(2)8-32-17(24-20)11-6-25(3)13-4-10(21)5-14(27)15(11)13/h4-6,9,12,26-27H,7-8H2,1-3H3,(H,22,31)(H,23,28)(H,29,30)/t9-,12+,20-/m1/s1 |
| InChIKey | NKNDHRJPCHKCQG-GNGCRJPWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies Sp080513GE-23 (ncbitaxon:630397) | - | PubMed (20146504) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| JBIR-35 (CHEBI:208071) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| (2S)-2-[[(2R)-2-[[(4R)-2-(6-chloro-4-hydroxy-1-methylindol-3-yl)-4-methyl-5H-1,3-oxazole-4-carbonyl]amino]propanoyl]amino]-3-hydroxypropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 24660662 | ChemSpider |