EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H28N2O6 |
| Net Charge | 0 |
| Average Mass | 452.507 |
| Monoisotopic Mass | 452.19474 |
| SMILES | C=CC(C)(C)[C@]1(C[C@H](NC(=O)[C@@H](O)Cc2ccccc2)C(=O)O)C(=O)Nc2c(O)cccc21 |
| InChI | InChI=1S/C25H28N2O6/c1-4-24(2,3)25(16-11-8-12-18(28)20(16)27-23(25)33)14-17(22(31)32)26-21(30)19(29)13-15-9-6-5-7-10-15/h4-12,17,19,28-29H,1,13-14H2,2-3H3,(H,26,30)(H,27,33)(H,31,32)/t17-,19-,25-/m0/s1 |
| InChIKey | TXVLBRMNUYNGCT-KMEZTADASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillusspecies MEXU 27854 (ncbitaxon:2801328) | - | PubMed (28796494) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Seco-PF1233 B carboxylic acid (CHEBI:208061) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| (2S)-3-[(3S)-7-hydroxy-3-(2-methylbut-3-en-2-yl)-2-oxo-1H-indol-3-yl]-2-[[(2S)-2-hydroxy-3-phenylpropanoyl]amino]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 62233293 | ChemSpider |