EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20O5 |
| Net Charge | 0 |
| Average Mass | 280.320 |
| Monoisotopic Mass | 280.13107 |
| SMILES | CC1=CC(=O)C[C@](C)(CO)[C@@]1(O)/C=C/C(C)=C\C(=O)O |
| InChI | InChI=1S/C15H20O5/c1-10(6-13(18)19)4-5-15(20)11(2)7-12(17)8-14(15,3)9-16/h4-7,16,20H,8-9H2,1-3H3,(H,18,19)/b5-4+,10-6-/t14-,15-/m1/s1 |
| InChIKey | AVFORCKFTWHFAR-ZSIFGTMLSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-8'-hydroxyabscisic acid (CHEBI:20805) has functional parent 2-cis-abscisic acid (CHEBI:22152) |
| (+)-8'-hydroxyabscisic acid (CHEBI:20805) is a apo carotenoid sesquiterpenoid (CHEBI:36758) |
| (+)-8'-hydroxyabscisic acid (CHEBI:20805) is conjugate acid of (+)-8'-hydroxyabscisate (CHEBI:58490) |
| Incoming Relation(s) |
| (+)-8'-hydroxyabscisate (CHEBI:58490) is conjugate base of (+)-8'-hydroxyabscisic acid (CHEBI:20805) |
| IUPAC Name |
|---|
| (2Z,4E)-5-[(1R,6R)-1-hydroxy-6-(hydroxymethyl)-2,6-dimethyl-4-oxocyclohex-2-en-1-yl]-3-methylpenta-2,4-dienoic acid |
| Manual Xrefs | Databases |
|---|---|
| C15514 | KEGG COMPOUND |