EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H14O6 |
| Net Charge | 0 |
| Average Mass | 362.337 |
| Monoisotopic Mass | 362.07904 |
| SMILES | CC(C)c1cc(=O)c2c(cc(O)c3c(=O)c4c(O)cccc4c(=O)c32)c1=O |
| InChI | InChI=1S/C21H14O6/c1-8(2)10-6-13(23)15-11(19(10)25)7-14(24)17-18(15)20(26)9-4-3-5-12(22)16(9)21(17)27/h3-8,22,24H,1-2H3 |
| InChIKey | VICNIIRXDNRZGY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nocardiopsis (ncbitaxon:2013) | - | PubMed (30417139) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nocardiopsistin A (CHEBI:208049) is a phenanthrol (CHEBI:25962) |
| IUPAC Name |
|---|
| 6,8-dihydroxy-3-propan-2-ylbenzo[a]anthracene-1,4,7,12-tetrone |
| Manual Xrefs | Databases |
|---|---|
| 71048552 | ChemSpider |