EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H14O5 |
| Net Charge | 0 |
| Average Mass | 238.239 |
| Monoisotopic Mass | 238.08412 |
| SMILES | CC(O)C[C@H]1Cc2cc(O)cc(O)c2C(=O)O1 |
| InChI | InChI=1S/C12H14O5/c1-6(13)2-9-4-7-3-8(14)5-10(15)11(7)12(16)17-9/h3,5-6,9,13-15H,2,4H2,1H3/t6?,9-/m0/s1 |
| InChIKey | ZQEPHXRTYHLRFV-HSOSERFQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cladosporium (ncbitaxon:5498) | - | PubMed (29223616) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3R)-3-(2-hydroxypropyl)-6,8-dihydroxy-3,4-dihydroisocoumarin (CHEBI:208032) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| (3R)-6,8-dihydroxy-3-(2-hydroxypropyl)-3,4-dihydroisochromen-1-one |
| Manual Xrefs | Databases |
|---|---|
| 71048973 | ChemSpider |