EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H44O5 |
| Net Charge | 0 |
| Average Mass | 460.655 |
| Monoisotopic Mass | 460.31887 |
| SMILES | C[C@@H]([C@@H](O)[C@@H](O)[C@](C)(O)[C@H]1CC[C@H]2[C@@H]3C=CC4=CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C)C(C)(C)O |
| InChI | InChI=1S/C28H44O5/c1-16(25(2,3)32)23(30)24(31)28(6,33)22-10-9-20-19-8-7-17-15-18(29)11-13-26(17,4)21(19)12-14-27(20,22)5/h7-8,15-16,19-24,30-33H,9-14H2,1-6H3/t16-,19-,20-,21-,22-,23+,24+,26-,27-,28+/m0/s1 |
| InChIKey | SZOUQAKVOGMLFN-AAZRRUSXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cladosporium (ncbitaxon:5498) | - | PubMed (29223616) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cladosporisteroid A (CHEBI:208021) is a bile acid (CHEBI:3098) |
| IUPAC Name |
|---|
| (8S,9S,10R,13S,14S,17S)-10,13-dimethyl-17-[(2R,3R,4R,5S)-2,3,4,6-tetrahydroxy-5,6-dimethylheptan-2-yl]-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
| Manual Xrefs | Databases |
|---|---|
| 71048971 | ChemSpider |