EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H31NO4 |
| Net Charge | 0 |
| Average Mass | 397.515 |
| Monoisotopic Mass | 397.22531 |
| SMILES | CC=C[C@@H]1C=C2C=C[C@@H]3C[C@H](C)CC[C@H]3[C@]2(C)C(=O)[C@@]12C(=O)N[C@@H]([C@@H](C)O)C2=O |
| InChI | InChI=1S/C24H31NO4/c1-5-6-17-12-16-9-8-15-11-13(2)7-10-18(15)23(16,4)21(28)24(17)20(27)19(14(3)26)25-22(24)29/h5-6,8-9,12-15,17-19,26H,7,10-11H2,1-4H3,(H,25,29)/t13-,14-,15-,17-,18-,19+,23-,24-/m1/s1 |
| InChIKey | LYRFDYFCOSNCHT-RNMHTRDWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alternaria (ncbitaxon:5598) | - | PubMed (30978906) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Altercrasin D (CHEBI:207970) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| (2R,3S,4aS,4bR,5'S,7R,8aS)-5'-[(1R)-1-hydroxyethyl]-4a,7-dimethyl-2-prop-1-enylspiro[4b,5,6,7,8,8a-hexahydro-2H-phenanthrene-3,3'-pyrrolidine]-2',4,4'-trione |