EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H40NO9P |
| Net Charge | 0 |
| Average Mass | 517.556 |
| Monoisotopic Mass | 517.24407 |
| SMILES | CN(C)[C@@H](C=CC(=O)O)[C@@H](O)C=C[C@@](C)(O)[C@@H](CC(O)C=CC=CC1CCCCC1)OP(=O)(O)O |
| InChI | InChI=1S/C24H40NO9P/c1-24(30,16-15-21(27)20(25(2)3)13-14-23(28)29)22(34-35(31,32)33)17-19(26)12-8-7-11-18-9-5-4-6-10-18/h7-8,11-16,18-22,26-27,30H,4-6,9-10,17H2,1-3H3,(H,28,29)(H2,31,32,33)/t19?,20-,21-,22+,24+/m0/s1 |
| InChIKey | JQMRWKPAJQOQLP-YKQINUBWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (23914940) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Phoslactomycin H (CHEBI:207967) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| (4S,5S,8R,9R)-15-cyclohexyl-4-(dimethylamino)-5,8,11-trihydroxy-8-methyl-9-phosphonooxypentadeca-2,6,12,14-tetraenoic acid |