EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:207934 - L-2-Amino-4-(2-aminoethoxy)-butanoic acid
| Formula | C6H14N2O3 |
| Net Charge | 0 |
| Average Mass | 162.189 |
| Monoisotopic Mass | 162.10044 |
| SMILES | NCCOCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C6H14N2O3/c7-2-4-11-3-1-5(8)6(9)10/h5H,1-4,7-8H2,(H,9,10)/t5-/m0/s1 |
| InChIKey | FDDYPVBIHWFLOI-YFKPBYRVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (931793) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-2-Amino-4-(2-aminoethoxy)-butanoic acid (CHEBI:207934) is a L-α-amino acid (CHEBI:15705) |
| IUPAC Name |
|---|
| (2S)-2-amino-4-(2-aminoethoxy)butanoic acid |