EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H35N7O12S |
| Net Charge | 0 |
| Average Mass | 693.692 |
| Monoisotopic Mass | 693.20644 |
| SMILES | CS(=O)(=O)c1ccc(C(=O)N[C@H](CCCN=C(N)NC(=O)c2cccc(O)c2O)C(=O)NCC(=O)N[C@H]2CCCN(O)C2=O)c(O)c1O |
| InChI | InChI=1S/C28H35N7O12S/c1-48(46,47)19-10-9-15(22(39)23(19)40)24(41)33-16(26(43)31-13-20(37)32-17-7-4-12-35(45)27(17)44)6-3-11-30-28(29)34-25(42)14-5-2-8-18(36)21(14)38/h2,5,8-10,16-17,36,38-40,45H,3-4,6-7,11-13H2,1H3,(H,31,43)(H,32,37)(H,33,41)(H3,29,30,34,42)/t16-,17+/m1/s1 |
| InChIKey | PWKIBNJRODWPRK-SJORKVTESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rhodococcus erythropolis PR4 (ncbitaxon:234621) | - | PubMed (24274668) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Apo-heterobactin S2 (CHEBI:207924) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| N-[(2R)-5-[[amino-[(2,3-dihydroxybenzoyl)amino]methylidene]amino]-1-[[2-[[(3S)-1-hydroxy-2-oxopiperidin-3-yl]amino]-2-oxoethyl]amino]-1-oxopentan-2-yl]-2,3-dihydroxy-4-methylsulonylbenzamide |
| Manual Xrefs | Databases |
|---|---|
| 78439834 | ChemSpider |