EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28N4O5 |
| Net Charge | 0 |
| Average Mass | 404.467 |
| Monoisotopic Mass | 404.20597 |
| SMILES | Cc1cc(N)c([C@@H]2CC(=O)[C@H](C)NC(=O)/C=C/[C@@H](O)CC[C@H](C)NC2=O)c(=O)n1 |
| InChI | InChI=1S/C20H28N4O5/c1-10-4-5-13(25)6-7-17(27)24-12(3)16(26)9-14(19(28)22-10)18-15(21)8-11(2)23-20(18)29/h6-8,10,12-14,25H,4-5,9H2,1-3H3,(H,22,28)(H,24,27)(H3,21,23,29)/b7-6+/t10-,12-,13-,14-/m0/s1 |
| InChIKey | XZOYKSWUMHBJPJ-WGFHNXPCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cordyceps gunnii (ncbitaxon:99897) | - | PubMed (28562046) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gunnilactam C (CHEBI:207884) is a aminopyridine (CHEBI:38207) |
| IUPAC Name |
|---|
| (3S,6S,9E,11S,14S)-3-(4-amino-6-methyl-2-oxo-1H-pyridin-3-yl)-11-hydroxy-6,14-dimethyl-1,7-diazacyclotetradec-9-ene-2,5,8-trione |
| Manual Xrefs | Databases |
|---|---|
| 78438983 | ChemSpider |