EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22O3 |
| Net Charge | 0 |
| Average Mass | 250.338 |
| Monoisotopic Mass | 250.15689 |
| SMILES | CC(=CC(=O)O)[C@@H]1OCC23CCCC(C)(C)[C@H]2[C@H]13 |
| InChI | InChI=1S/C15H22O3/c1-9(7-10(16)17)12-11-13-14(2,3)5-4-6-15(11,13)8-18-12/h7,11-13H,4-6,8H2,1-3H3,(H,16,17)/t11-,12-,13+,15?/m0/s1 |
| InChIKey | ZTYVCEZGXCLVBN-KIFYNCCSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tropicoporus linteus (ncbitaxon:1659895) | - | DOI (10.1016/j.tetlet.2013.04.027) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Phellilin C (CHEBI:207875) is a heterocyclic fatty acid (CHEBI:48847) |
| IUPAC Name |
|---|
| 3-[(4R,5S,6R)-7,7-dimethyl-3-oxatricyclo[4.4.0.01,5]decan-4-yl]but-2-enoic acid |