EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H20N2O3 |
| Net Charge | 0 |
| Average Mass | 300.358 |
| Monoisotopic Mass | 300.14739 |
| SMILES | COC(=O)/C(Cc1cnc2c(CC=C(C)C)cccc12)=N\O |
| InChI | InChI=1S/C17H20N2O3/c1-11(2)7-8-12-5-4-6-14-13(10-18-16(12)14)9-15(19-21)17(20)22-3/h4-7,10,18,21H,8-9H2,1-3H3/b19-15- |
| InChIKey | HQNOGRIAKMEIFV-CYVLTUHYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus terreus (ncbitaxon:33178) | - | PubMed (30014920) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Luteoride E (CHEBI:207869) is a indolyl carboxylic acid (CHEBI:46867) |