EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H26N2O4 |
| Net Charge | 0 |
| Average Mass | 274.361 |
| Monoisotopic Mass | 274.18926 |
| SMILES | CCCCC[C@@H](N)[C@H](O)C(=O)N[C@H](C(=O)O)C(C)C |
| InChI | InChI=1S/C13H26N2O4/c1-4-5-6-7-9(14)11(16)12(17)15-10(8(2)3)13(18)19/h8-11,16H,4-7,14H2,1-3H3,(H,15,17)(H,18,19)/t9-,10+,11+/m1/s1 |
| InChIKey | OQQQLESSZVHSFL-VWYCJHECSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (8882425) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Valinoctin A (CHEBI:207868) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2S)-2-[[(2S,3R)-3-amino-2-hydroxyoctanoyl]amino]-3-methylbutanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 8644000 | ChemSpider |