EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H32N2O9 |
| Net Charge | 0 |
| Average Mass | 528.558 |
| Monoisotopic Mass | 528.21078 |
| SMILES | CCC(C)C(=O)OC1C(C)OC(=O)C(NC(=O)c2nccc(OC)c2O)COC(=O)C1Cc1ccccc1 |
| InChI | InChI=1S/C27H32N2O9/c1-5-15(2)25(32)38-23-16(3)37-27(34)19(29-24(31)21-22(30)20(35-4)11-12-28-21)14-36-26(33)18(23)13-17-9-7-6-8-10-17/h6-12,15-16,18-19,23,30H,5,13-14H2,1-4H3,(H,29,31) |
| InChIKey | GIOFZQIXBXPMAB-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (8784423) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| UK-2D (CHEBI:207844) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| [8-benzyl-3-[(3-hydroxy-4-methoxypyridine-2-carbonyl)amino]-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylbutanoate |
| Manual Xrefs | Databases |
|---|---|
| 411707 | ChemSpider |