EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H20O4 |
| Net Charge | 0 |
| Average Mass | 216.277 |
| Monoisotopic Mass | 216.13616 |
| SMILES | CC[C@H](O)[C@@H]1C[C@@H](CCCC(=O)O)CO1 |
| InChI | InChI=1S/C11H20O4/c1-2-9(12)10-6-8(7-15-10)4-3-5-11(13)14/h8-10,12H,2-7H2,1H3,(H,13,14)/t8-,9+,10+/m1/s1 |
| InChIKey | KOGNSOVIFNEWCD-UTLUCORTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Podospora communis (ncbitaxon:438773) | - | DOI (10.1016/j.tetlet.2004.07.093) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Communiol A (CHEBI:207843) is a heterocyclic fatty acid (CHEBI:48847) |
| IUPAC Name |
|---|
| 4-[(3R,5S)-5-[(1S)-1-hydroxypropyl]oxolan-3-yl]butanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 8280270 | ChemSpider |