EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H18O4 |
| Net Charge | 0 |
| Average Mass | 226.272 |
| Monoisotopic Mass | 226.12051 |
| SMILES | COC(=O)[C@@H](C)/C=C(\C)C/C(C)=C/C(=O)O |
| InChI | InChI=1S/C12H18O4/c1-8(5-9(2)7-11(13)14)6-10(3)12(15)16-4/h6-7,10H,5H2,1-4H3,(H,13,14)/b8-6+,9-7+/t10-/m0/s1 |
| InChIKey | PHAUMERUFLEEJS-LPCOJOSNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fusarium (ncbitaxon:5506) | - | PubMed (30791608) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fusarisolin E (CHEBI:207813) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (2E,5E,7S)-8-methoxy-3,5,7-trimethyl-8-oxoocta-2,5-dienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 71120867 | ChemSpider |