EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H34O5 |
| Net Charge | 0 |
| Average Mass | 366.498 |
| Monoisotopic Mass | 366.24062 |
| SMILES | CC(=C\C(=O)O)/C=C(\C)C[C@H](C)CCCCC[C@@]1(C)C[C@@H](CO)C(=O)O1 |
| InChI | InChI=1S/C21H34O5/c1-15(10-16(2)11-17(3)12-19(23)24)8-6-5-7-9-21(4)13-18(14-22)20(25)26-21/h11-12,15,18,22H,5-10,13-14H2,1-4H3,(H,23,24)/b16-11+,17-12+/t15-,18+,21+/m1/s1 |
| InChIKey | GTNWPOFMIVGESM-QQGUQAMYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fusarium (ncbitaxon:5506) | - | PubMed (30791608) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fusarisolin B (CHEBI:207807) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| (2E,4E,7R)-12-[(2S,4S)-4-(hydroxymethyl)-2-methyl-5-oxooxolan-2-yl]-3,5,7-trimethyldodeca-2,4-dienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 71120864 | ChemSpider |