EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H36O5 |
| Net Charge | 0 |
| Average Mass | 404.547 |
| Monoisotopic Mass | 404.25627 |
| SMILES | C[C@H](CCC(=O)O)C1CCC2C3C(=O)CC4CC(=O)CC[C@]4(C)C3C[C@H](O)[C@@]21C |
| InChI | InChI=1S/C24H36O5/c1-13(4-7-21(28)29)16-5-6-17-22-18(12-20(27)24(16,17)3)23(2)9-8-15(25)10-14(23)11-19(22)26/h13-14,16-18,20,22,27H,4-12H2,1-3H3,(H,28,29)/t13-,14?,16?,17?,18?,20+,22?,23+,24-/m1/s1 |
| InChIKey | NCQLOJDAPOEYJA-GBUYSHLLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Psychrobacterspecies (ncbitaxon:56811) | - | PubMed (19557363) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12alpha-Hydroxy-3,7-diketocholanic acid (CHEBI:207806) is a bile acid (CHEBI:3098) |
| IUPAC Name |
|---|
| (4R)-4-[(10S,12S,13R)-12-hydroxy-10,13-dimethyl-3,7-dioxo-2,4,5,6,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 30650423 | ChemSpider |