EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H32O3 |
| Net Charge | 0 |
| Average Mass | 296.451 |
| Monoisotopic Mass | 296.23514 |
| SMILES | C/C=C(C)\C=C(/C)C[C@H](C)CCCC[C@@H](O)[C@@H](C)C(=O)O |
| InChI | InChI=1S/C18H32O3/c1-6-13(2)11-15(4)12-14(3)9-7-8-10-17(19)16(5)18(20)21/h6,11,14,16-17,19H,7-10,12H2,1-5H3,(H,20,21)/b13-6-,15-11+/t14-,16-,17-/m1/s1 |
| InChIKey | OFEICKOWYHYGFA-RKJHCUITSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fusarium (ncbitaxon:5506) | - | PubMed (30791608) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fusarisolin D (CHEBI:207795) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| (2R,3R,8R,10E,12Z)-3-hydroxy-2,8,10,12-tetramethyltetradeca-10,12-dienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 71120866 | ChemSpider |