EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10Cl2O4 |
| Net Charge | 0 |
| Average Mass | 253.081 |
| Monoisotopic Mass | 251.99561 |
| SMILES | C/C=C/C1=C(Cl)[C@@H](O)[C@@H](Cl)[C@@]1(O)C(=O)O |
| InChI | InChI=1S/C9H10Cl2O4/c1-2-3-4-5(10)6(12)7(11)9(4,15)8(13)14/h2-3,6-7,12,15H,1H3,(H,13,14)/b3-2+/t6-,7-,9-/m1/s1 |
| InChIKey | CQCJNRAGFPJOFU-HQTIMQCISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phoma (ncbitaxon:37463) | - | DOI (10.1007/s00044-018-2201-1) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cryptophomic acid (CHEBI:207785) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| IUPAC Name |
|---|
| (1S,4S,5R)-3,5-dichloro-1,4-dihydroxy-2-[(E)-prop-1-enyl]cyclopent-2-ene-1-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 70951806 | ChemSpider |