EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H12O5 |
| Net Charge | 0 |
| Average Mass | 236.223 |
| Monoisotopic Mass | 236.06847 |
| SMILES | COc1cc(=O)oc(/C=C/C=C/C(=O)O)c1C |
| InChI | InChI=1S/C12H12O5/c1-8-9(5-3-4-6-11(13)14)17-12(15)7-10(8)16-2/h3-7H,1-2H3,(H,13,14)/b5-3+,6-4+ |
| InChIKey | ISQQPILYSRJHBC-GGWOSOGESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cladosporium herbarum (ncbitaxon:29918) | - | DOI (10.1021/np010390i) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Herbarin A (CHEBI:207778) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (2E,4E)-5-(4-methoxy-3-methyl-6-oxopyran-2-yl)penta-2,4-dienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 9217883 | ChemSpider |