EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H17NO6 |
| Net Charge | 0 |
| Average Mass | 307.302 |
| Monoisotopic Mass | 307.10559 |
| SMILES | COC1=CC(=O)OC1(O)C(C)CNc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C15H17NO6/c1-9(15(20)12(21-2)7-13(17)22-15)8-16-11-5-3-10(4-6-11)14(18)19/h3-7,9,16,20H,8H2,1-2H3,(H,18,19) |
| InChIKey | FFZDJCBPACTOIH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus ochraceus (ncbitaxon:40380) | - | PubMed (30717441) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ochraspergillic acid B (CHEBI:207764) is a aminobenzoic acid (CHEBI:22495) |
| IUPAC Name |
|---|
| 4-[2-(2-hydroxy-3-methoxy-5-oxouran-2-yl)propylamino]benzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 71120862 | ChemSpider |