EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26N4O8 |
| Net Charge | 0 |
| Average Mass | 450.448 |
| Monoisotopic Mass | 450.17506 |
| SMILES | CC(C)C[C@]1(O)NC(=O)[C@@H](C(C)(C)OC(=O)CNC(=O)c2ccc([N+](=O)[O-])cc2)NC1=O |
| InChI | InChI=1S/C20H26N4O8/c1-11(2)9-20(29)18(28)22-15(17(27)23-20)19(3,4)32-14(25)10-21-16(26)12-5-7-13(8-6-12)24(30)31/h5-8,11,15,29H,9-10H2,1-4H3,(H,21,26)(H,22,28)(H,23,27)/t15-,20+/m0/s1 |
| InChIKey | SEMSKEFCCXVCQD-MGPUTAFESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus ochraceus (ncbitaxon:40380) | - | PubMed (30717441) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Waspergillamide B (CHEBI:207754) is a N-acylglycine (CHEBI:16180) |
| IUPAC Name |
|---|
| 2-[(2R,5R)-5-hydroxy-5-(2-methylpropyl)-3,6-dioxopiperazin-2-yl]propan-2-yl 2-[(4-nitrobenzoyl)amino]acetate |
| Manual Xrefs | Databases |
|---|---|
| 71120860 | ChemSpider |