EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H34O9 |
| Net Charge | 0 |
| Average Mass | 502.560 |
| Monoisotopic Mass | 502.22028 |
| SMILES | C=C[C@]1(C)C=C2C(=O)C(O)=C3C(C)(C)CCC[C@]3(C(=O)O[C@H]3C(=O)C=C(OC)[C@@H](O)[C@H]3O)[C@@]2(O)CC1 |
| InChI | InChI=1S/C27H34O9/c1-6-25(4)10-11-27(34)14(13-25)17(29)20(32)22-24(2,3)8-7-9-26(22,27)23(33)36-21-15(28)12-16(35-5)18(30)19(21)31/h6,12-13,18-19,21,30-32,34H,1,7-11H2,2-5H3/t18-,19-,21+,25+,26+,27-/m1/s1 |
| InChIKey | QRKUDJZMRTVQRY-SJJDIPSKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Neofusicoccum laricinum (ncbitaxon:121618) | - | PubMed (28609099) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Botrysphin E (CHEBI:207752) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| [(1R,5S,6R)-5,6-dihydroxy-4-methoxy-2-oxocyclohex-3-en-1-yl] (4aR,4bR,7R)-7-ethenyl-4b,10-dihydroxy-1,1,7-trimethyl-9-oxo-3,4,5,6-tetrahydro-2H-phenanthrene-4a-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| 78441642 | ChemSpider |