EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10O6 |
| Net Charge | 0 |
| Average Mass | 226.184 |
| Monoisotopic Mass | 226.04774 |
| SMILES | COc1cc(C(=O)O)cc(OC)c1C(=O)O |
| InChI | InChI=1S/C10H10O6/c1-15-6-3-5(9(11)12)4-7(16-2)8(6)10(13)14/h3-4H,1-2H3,(H,11,12)(H,13,14) |
| InChIKey | XZZNMOQLQQVIFN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (23972103) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,6-dimethoxy terephthalic acid (CHEBI:207737) is a 2-hydroxyisophthalic acid (CHEBI:19643) |
| IUPAC Name |
|---|
| 2,6-dimethoxyterephthalic acid |
| Manual Xrefs | Databases |
|---|---|
| 77213 | ChemSpider |