EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H28O7 |
| Net Charge | 0 |
| Average Mass | 428.481 |
| Monoisotopic Mass | 428.18350 |
| SMILES | Cc1c(O)c(C)c2c(c1O)C(=O)O[C@@](C)(Oc1cc(O)c3c(c1C)[C@@H](C)[C@H](C)OC3)C2 |
| InChI | InChI=1S/C24H28O7/c1-10-14(5)29-9-16-17(25)7-18(12(3)19(10)16)30-24(6)8-15-11(2)21(26)13(4)22(27)20(15)23(28)31-24/h7,10,14,25-27H,8-9H2,1-6H3/t10-,14-,24+/m0/s1 |
| InChIKey | QNPFUVLURYJZBM-BGJCVAEFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium (ncbitaxon:5073) | - | PubMed (30634700) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Penicitol D (CHEBI:207727) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| (3R)-6,8-dihydroxy-3-[[(3S,4R)-8-hydroxy-3,4,5-trimethyl-3,4-dihydro-1H-isochromen-6-yl]oxy]-3,5,7-trimethyl-4H-isochromen-1-one |
| Manual Xrefs | Databases |
|---|---|
| 71115944 | ChemSpider |