EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H14O5 |
| Net Charge | 0 |
| Average Mass | 226.228 |
| Monoisotopic Mass | 226.08412 |
| SMILES | COC(=O)CCC(=O)c1ccc([C@@H](C)O)o1 |
| InChI | InChI=1S/C11H14O5/c1-7(12)9-4-5-10(16-9)8(13)3-6-11(14)15-2/h4-5,7,12H,3,6H2,1-2H3/t7-/m1/s1 |
| InChIKey | GTUBQHDUMJNQSV-SSDOTTSWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Diaporthespecies XZ-07 (ncbitaxon:357840) | - | DOI (10.1002/hlca.200800416) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl 5-[(1R)-1-hydroxyethyl]-gamma-oxofuran-2-butanoate (CHEBI:207714) is a oxo carboxylic acid (CHEBI:25754) |
| IUPAC Name |
|---|
| methyl 4-[5-[(1R)-1-hydroxyethyl]uran-2-yl]-4-oxobutanoate |
| Manual Xrefs | Databases |
|---|---|
| 78441280 | ChemSpider |