EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48N6O7 |
| Net Charge | 0 |
| Average Mass | 604.749 |
| Monoisotopic Mass | 604.35845 |
| SMILES | CC(C)C[C@H](NC(=O)C(O)Cc1ccc(O)cc1)C(=O)N1C(C(=O)NC(CO)CCCN=C(N)N)CC2CCC(O)CC21 |
| InChI | InChI=1S/C30H48N6O7/c1-17(2)12-23(35-28(42)26(40)13-18-5-8-21(38)9-6-18)29(43)36-24-15-22(39)10-7-19(24)14-25(36)27(41)34-20(16-37)4-3-11-33-30(31)32/h5-6,8-9,17,19-20,22-26,37-40H,3-4,7,10-16H2,1-2H3,(H,34,41)(H,35,42)(H4,31,32,33)/t19?,20?,22?,23-,24?,25?,26?/m0/s1 |
| InChIKey | ZRJNSRDWYFDFAT-RKTRNHPESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Microcystis aeruginosa NIES-298 (ncbitaxon:449468) | - | DOI (10.1016/s0040-4039(00)76848-1) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Aeruginosin 298-A (CHEBI:207701) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| N-[5-(diaminomethylideneamino)-1-hydroxypentan-2-yl]-6-hydroxy-1-[(2S)-2-[[2-hydroxy-3-(4-hydroxyphenyl)propanoyl]amino]-4-methylpentanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
| Manual Xrefs | Databases |
|---|---|
| 8501772 | ChemSpider |