EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H16O8 |
| Net Charge | 0 |
| Average Mass | 288.252 |
| Monoisotopic Mass | 288.08452 |
| SMILES | C=C(O[C@@H]1C=C(C(=O)OC)[C@H](O)[C@@H](O)[C@H]1O)C(=O)OC |
| InChI | InChI=1S/C12H16O8/c1-5(11(16)18-2)20-7-4-6(12(17)19-3)8(13)10(15)9(7)14/h4,7-10,13-15H,1H2,2-3H3/t7-,8+,9+,10-/m1/s1 |
| InChIKey | VTWHFQDOQSSIID-XFWSIPNHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Clitocybe (ncbitaxon:50966) | - | DOI (10.1016/s0040-4020(01)87202-1) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cyathiformine B (CHEBI:207678) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| IUPAC Name |
|---|
| methyl (3R,4R,5R,6S)-4,5,6-trihydroxy-3-(3-methoxy-3-oxoprop-1-en-2-yl)oxycyclohexene-1-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| 8441576 | ChemSpider |