EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H31N5O7S3 |
| Net Charge | 0 |
| Average Mass | 609.752 |
| Monoisotopic Mass | 609.13856 |
| SMILES | COC(=O)[C@H](CSC)N(C)C(=O)[C@@H]1CSSC[C@@H](NC(=O)c2nc3ccccc3cc2O)C(=O)NCC(=O)N1C |
| InChI | InChI=1S/C25H31N5O7S3/c1-29-17(24(35)30(2)18(12-38-4)25(36)37-3)13-40-39-11-16(22(33)26-10-20(29)32)28-23(34)21-19(31)9-14-7-5-6-8-15(14)27-21/h5-9,16-18,31H,10-13H2,1-4H3,(H,26,33)(H,28,34)/t16-,17+,18+/m1/s1 |
| InChIKey | SSNMADOPSZXXTG-SQNIBIBYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Verrucosisporaspecies (ncbitaxon:1871626) | - | PubMed (21736356) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Thiochondrilline C (CHEBI:207674) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| methyl (2R)-2-[[(4R,10S)-10-[(3-hydroxyquinoline-2-carbonyl)amino]-5-methyl-6,9-dioxo-1,2-dithia-5,8-diazacycloundecane-4-carbonyl]-methylamino]-3-methylsulanylpropanoate |
| Manual Xrefs | Databases |
|---|---|
| 28185143 | ChemSpider |