EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H37NO7 |
| Net Charge | 0 |
| Average Mass | 475.582 |
| Monoisotopic Mass | 475.25700 |
| SMILES | CCCCCC[C@H]1C(=O)O[C@H](C)[C@H](NC(=O)c2ccccc2)C(=O)O[C@@H](C)[C@@H]1OC(=O)C(C)C |
| InChI | InChI=1S/C26H37NO7/c1-6-7-8-12-15-20-22(34-24(29)16(2)3)18(5)33-26(31)21(17(4)32-25(20)30)27-23(28)19-13-10-9-11-14-19/h9-11,13-14,16-18,20-22H,6-8,12,15H2,1-5H3,(H,27,28)/t17-,18+,20-,21+,22+/m1/s1 |
| InChIKey | SSQVYIIIOZZEAD-UXJHKWJQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (28358337) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Neoantimycin B (CHEBI:207650) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| [(2R,3S,6S,7R,8R)-3-benzamido-8-hexyl-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate |
| Manual Xrefs | Databases |
|---|---|
| 61708463 | ChemSpider |