EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20O5 |
| Net Charge | 0 |
| Average Mass | 280.320 |
| Monoisotopic Mass | 280.13107 |
| SMILES | CC(=C/C(=O)O)/C=C/C1(O)C(CO)=CC(=O)CC1(C)C |
| InChI | InChI=1S/C15H20O5/c1-10(6-13(18)19)4-5-15(20)11(9-16)7-12(17)8-14(15,2)3/h4-7,16,20H,8-9H2,1-3H3,(H,18,19)/b5-4+,10-6- |
| InChIKey | ZGHRCSAIMSBFLK-IGTFLHFFSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7'-hydroxyabscisic acid (CHEBI:20764) has functional parent 2-cis-abscisic acid (CHEBI:22152) |
| 7'-hydroxyabscisic acid (CHEBI:20764) is a oxo monocarboxylic acid (CHEBI:35871) |
| 7'-hydroxyabscisic acid (CHEBI:20764) is a primary alcohol (CHEBI:15734) |
| 7'-hydroxyabscisic acid (CHEBI:20764) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (2Z,4E)-5-[1-hydroxy-2-(hydroxymethyl)-6,6-dimethyl-4-oxocyclohex-2-en-1-yl]-3-methylpenta-2,4-dienoic acid |
| Synonym | Source |
|---|---|
| (±)-7'-hydroxyabscisic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4355109 | Reaxys |