EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H14O6 |
| Net Charge | 0 |
| Average Mass | 290.271 |
| Monoisotopic Mass | 290.07904 |
| SMILES | COc1cc2c(c(C(=O)O)c1)C1=C(CO2)C(=O)C[C@H](C)O1 |
| InChI | InChI=1S/C15H14O6/c1-7-3-11(16)10-6-20-12-5-8(19-2)4-9(15(17)18)13(12)14(10)21-7/h4-5,7H,3,6H2,1-2H3,(H,17,18)/t7-/m0/s1 |
| InChIKey | GXFWWJQCONQVDE-ZETCQYMHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Graphisspecies (in: ascomycete fungi) (ncbitaxon:2046666) | - | DOI (10.3987/com-13-12853) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-(-)-8-methoxy-2-methyl-4-oxo-3,4-dihydro-2H,5H-pyrano[3,2-c]chromene-10-carboxylic acid (CHEBI:207626) is a methoxybenzoic acid (CHEBI:25238) |
| IUPAC Name |
|---|
| (2S)-8-methoxy-2-methyl-4-oxo-3,5-dihydro-2H-pyrano[3,2-c]chromene-10-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 78437339 | ChemSpider |