EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H16O4 |
| Net Charge | 0 |
| Average Mass | 224.256 |
| Monoisotopic Mass | 224.10486 |
| SMILES | CCC(=O)CCc1ccc(C(=O)[C@H](C)O)o1 |
| InChI | InChI=1S/C12H16O4/c1-3-9(14)4-5-10-6-7-11(16-10)12(15)8(2)13/h6-8,13H,3-5H2,1-2H3/t8-/m0/s1 |
| InChIKey | SHVLDFMVBSKNIK-QMMMGPOBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Coriolopsis (ncbitaxon:76125) | - | PubMed (28208775) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-(5-(2-hydroxypropanoyl)-furan-2-yl)-pentan-3-one (CHEBI:207588) is a heterocyclic fatty acid (CHEBI:48847) |
| IUPAC Name |
|---|
| 1-[5-(2-hydroxypropanoyl)uran-2-yl]pentan-3-one |
| Manual Xrefs | Databases |
|---|---|
| 61360280 | ChemSpider |