EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H22N4O4 |
| Net Charge | 0 |
| Average Mass | 526.552 |
| Monoisotopic Mass | 526.16411 |
| SMILES | O=C(O)[C@@H]1Cc2c(nc3ccccc23)C2(N1)C(=O)C(c1cnc3ccccc13)=C(c1cnc3ccccc13)C2=O |
| InChI | InChI=1S/C32H22N4O4/c37-29-26(20-14-33-22-10-4-1-8-17(20)22)27(21-15-34-23-11-5-2-9-18(21)23)30(38)32(29)28-19(13-25(36-32)31(39)40)16-7-3-6-12-24(16)35-28/h1-12,14-15,25,33-36H,13H2,(H,39,40)/t25-/m0/s1 |
| InChIKey | MTYFENJTEZHZIP-VWLOTQADSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malassezia furfur (ncbitaxon:55194) | - | PubMed (14983444) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pityriarubin A (CHEBI:207551) is a harmala alkaloid (CHEBI:61379) |
| IUPAC Name |
|---|
| (3S)-1',2'-bis(1H-indol-3-yl)-3',5'-dioxospiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,4'-cyclopentene]-3-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 9378359 | ChemSpider |