EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H28N2O8 |
| Net Charge | 0 |
| Average Mass | 436.461 |
| Monoisotopic Mass | 436.18457 |
| SMILES | CC(C)C(=O)O[C@H]1[C@H](C)OC(=O)[C@@H](NC(=O)c2cccc(N)c2O)[C@@H](C)OC(=O)[C@@H]1C |
| InChI | InChI=1S/C21H28N2O8/c1-9(2)19(26)31-17-10(3)20(27)29-11(4)15(21(28)30-12(17)5)23-18(25)13-7-6-8-14(22)16(13)24/h6-12,15,17,24H,22H2,1-5H3,(H,23,25)/t10-,11-,12+,15+,17-/m1/s1 |
| InChIKey | WHRRCTVCKVGFOK-IXNOIGBVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces somaliensis (ncbitaxon:78355) | - | PubMed (28469615) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Somalimycin (CHEBI:207528) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| [(2R,3S,6S,7R,8R)-3-[(3-amino-2-hydroxybenzoyl)amino]-2,6,8-trimethyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate |
| Manual Xrefs | Databases |
|---|---|
| 62285027 | ChemSpider |