EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H14O3 |
| Net Charge | 0 |
| Average Mass | 158.197 |
| Monoisotopic Mass | 158.09429 |
| SMILES | C[C@H](O)C(C)(C)/C=C/C(=O)O |
| InChI | InChI=1S/C8H14O3/c1-6(9)8(2,3)5-4-7(10)11/h4-6,9H,1-3H3,(H,10,11)/b5-4+/t6-/m0/s1 |
| InChIKey | CZVIGISAALDFFI-OVCGOVNKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Graphostromaspecies (ncbitaxon:1933438) | - | PubMed (31368179) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Graphostromol H (CHEBI:207514) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (E,5S)-5-hydroxy-4,4-dimethylhex-2-enoic acid |