EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H37N7O9 |
| Net Charge | 0 |
| Average Mass | 591.622 |
| Monoisotopic Mass | 591.26528 |
| SMILES | CN[C@@H](CCCN(O)C(=O)CCNC(=O)CNC(=O)[C@H]1COC(c2ccccc2O)=N1)C(=O)N[C@H]1CCCN(O)C1=O |
| InChI | InChI=1S/C26H37N7O9/c1-27-17(24(38)30-18-8-5-13-33(41)26(18)39)7-4-12-32(40)22(36)10-11-28-21(35)14-29-23(37)19-15-42-25(31-19)16-6-2-3-9-20(16)34/h2-3,6,9,17-19,27,34,40-41H,4-5,7-8,10-15H2,1H3,(H,28,35)(H,29,37)(H,30,38)/t17-,18-,19+/m0/s1 |
| InChIKey | RHFPNLFQGRPOBC-GBESFXJTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Actinomadura (ncbitaxon:1988) | - | PubMed (28398740) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Madurastatin C1 (CHEBI:207511) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| (4R)-N-[2-[[3-[hydroxy-[(4S)-5-[[(3S)-1-hydroxy-2-oxopiperidin-3-yl]amino]-4-(methylamino)-5-oxopentyl]amino]-3-oxopropyl]amino]-2-oxoethyl]-2-(2-hydroxyphenyl)-4,5-dihydro-1,3-oxazole-4-carboxamide |
| Manual Xrefs | Databases |
|---|---|
| 62277915 | ChemSpider |