EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H31ClO7 |
| Net Charge | 0 |
| Average Mass | 418.914 |
| Monoisotopic Mass | 418.17583 |
| SMILES | CO[C@@H]1[C@H](OC(=O)CCC(=O)O)CC[C@](O)(CCl)[C@H]1[C@@]1(C)O[C@@H]1CC=C(C)C |
| InChI | InChI=1S/C20H31ClO7/c1-12(2)5-6-14-19(3,28-14)18-17(26-4)13(9-10-20(18,25)11-21)27-16(24)8-7-15(22)23/h5,13-14,17-18,25H,6-11H2,1-4H3,(H,22,23)/t13-,14-,17-,18-,19+,20+/m1/s1 |
| InChIKey | FKTJAQKUCINAIF-JNYDFHNISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicilliumspecies (ncbitaxon:5081) | - | PubMed (23360521) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ligerin (CHEBI:207471) is a epoxy fatty acid (CHEBI:61498) |
| IUPAC Name |
|---|
| 4-[(1R,2S,3S,4R)-4-(chloromethyl)-4-hydroxy-2-methoxy-3-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]cyclohexyl]oxy-4-oxobutanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 28637720 | ChemSpider |