EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H20O4 |
| Net Charge | 0 |
| Average Mass | 228.288 |
| Monoisotopic Mass | 228.13616 |
| SMILES | CCC(=O)[C@@H](C)[C@@H](O)/C=C/C(C)CC(=O)O |
| InChI | InChI=1S/C12H20O4/c1-4-10(13)9(3)11(14)6-5-8(2)7-12(15)16/h5-6,8-9,11,14H,4,7H2,1-3H3,(H,15,16)/b6-5+/t8?,9-,11+/m1/s1 |
| InChIKey | BQXZMOWTHZZDNJ-SYEHMEJWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Graphostromaspecies (ncbitaxon:1933438) | - | PubMed (31368179) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Graphostromol J (CHEBI:207459) is a oxo carboxylic acid (CHEBI:25754) |
| IUPAC Name |
|---|
| (E,6S,7S)-6-hydroxy-3,7-dimethyl-8-oxodec-4-enoic acid |