EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H42N6O8 |
| Net Charge | 0 |
| Average Mass | 626.711 |
| Monoisotopic Mass | 626.30641 |
| SMILES | C[C@H]1C[C@@H](C(=O)N[C@@H](CCCN=C(N)N)C(=O)O)N(C(=O)[C@@H](CCc2ccc(O)cc2)NC(=O)[C@H](O)Cc2ccc(O)cc2)C1 |
| InChI | InChI=1S/C31H42N6O8/c1-18-15-25(27(41)36-24(30(44)45)3-2-14-34-31(32)33)37(17-18)29(43)23(13-8-19-4-9-21(38)10-5-19)35-28(42)26(40)16-20-6-11-22(39)12-7-20/h4-7,9-12,18,23-26,38-40H,2-3,8,13-17H2,1H3,(H,35,42)(H,36,41)(H,44,45)(H4,32,33,34)/t18-,23+,24-,25-,26+/m0/s1 |
| InChIKey | MNCDUGJJFHDUNT-DXHIOLLYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nodulariaspeciesmigena AV1 (ncbitaxon:284707) | - | DOI (10.1016/s0040-4039(97)01192-1) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Spumigin B1 (CHEBI:207438) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| (2S)-5-(diaminomethylideneamino)-2-[[(2S,4S)-1-[(2R)-2-[[(2R)-2-hydroxy-3-(4-hydroxyphenyl)propanoyl]amino]-4-(4-hydroxyphenyl)butanoyl]-4-methylpyrrolidine-2-carbonyl]amino]pentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 9976745 | ChemSpider |