EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H24N2O7S2 |
| Net Charge | 0 |
| Average Mass | 444.531 |
| Monoisotopic Mass | 444.10249 |
| SMILES | C[C@H]1O[C@@]2(C[C@H]3N4C(=O)C5(CO)SS[C@]4(C[C@@]3(O)[C@@H]2O)C(=O)N5C)C(=O)C1(C)C |
| InChI | InChI=1S/C18H24N2O7S2/c1-8-14(2,3)10(22)16(27-8)5-9-15(26,11(16)23)6-17-12(24)19(4)18(7-21,29-28-17)13(25)20(9)17/h8-9,11,21,23,26H,5-7H2,1-4H3/t8-,9-,11+,15+,16+,17-,18?/m1/s1 |
| InChIKey | ODGGLAWTFMFKDG-RCRWIJFNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Microsphaeropsis (ncbitaxon:107453) | - | PubMed (8002382) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| TAN-1496-D (CHEBI:207396) is a 2,5-diketopiperazines (CHEBI:65061) |
| TAN-1496-D (CHEBI:207396) is a indoles (CHEBI:24828) |
| TAN-1496-D (CHEBI:207396) is a organic disulfide (CHEBI:35489) |
| TAN-1496-D (CHEBI:207396) is a organic heteropentacyclic compound (CHEBI:38164) |
| IUPAC Name |
|---|
| (1R,3S,4S,5R,5'R,7R)-3,4-dihydroxy-10-(hydroxymethyl)-4',4',5',14-tetramethylspiro[11,12-dithia-8,14-diazatetracyclo[8.2.2.01,8.03,7]tetradecane-5,2'-oxolane]-3',9,13-trione |