EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H22N4O4 |
| Net Charge | 0 |
| Average Mass | 418.453 |
| Monoisotopic Mass | 418.16411 |
| SMILES | C[C@@H]1NC(=O)[C@@H]2Cc3ccccc3N2C(=O)CNC(=O)[C@H]2Cc3ccccc3N2C1=O |
| InChI | InChI=1S/C23H22N4O4/c1-13-23(31)27-17-9-5-3-7-15(17)10-18(27)21(29)24-12-20(28)26-16-8-4-2-6-14(16)11-19(26)22(30)25-13/h2-9,13,18-19H,10-12H2,1H3,(H,24,29)(H,25,30)/t13-,18+,19-/m0/s1 |
| InChIKey | QGAQNBBMPPLZJS-BKTGTZMESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus versicolor (ncbitaxon:46472) | - | DOI (10.1039/c7ra07940k) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Versicotide D (CHEBI:207376) is a cyclic peptide (CHEBI:23449) |
| IUPAC Name |
|---|
| (1S,4S,14R)-4-methyl-3,6,16,19-tetrazapentacyclo[17.7.0.06,14.07,12.020,25]hexacosa-7,9,11,20,22,24-hexaene-2,5,15,18-tetrone |
| Manual Xrefs | Databases |
|---|---|
| 62453209 | ChemSpider |