EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H16O6 |
| Net Charge | 0 |
| Average Mass | 352.342 |
| Monoisotopic Mass | 352.09469 |
| SMILES | Oc1ccc2c3c1[C@@H](O)[C@@H]1O[C@@H]1[C@H]3c1ccc(O)c3c1[C@H]2[C@H]1O[C@H]1[C@@H]3O |
| InChI | InChI=1S/C20H16O6/c21-7-3-1-5-9-12(18-20(26-18)15(23)13(7)9)6-2-4-8(22)14-10(6)11(5)17-19(25-17)16(14)24/h1-4,11-12,15-24H/t11-,12-,15+,16+,17+,18+,19-,20-/m0/s1 |
| InChIKey | XSDHEAABYNNUIQ-YZRPZTIYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alternaria tenuissima (ncbitaxon:119927) | - | PubMed (24660902) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Altertoxin IV (CHEBI:207300) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| (2S,3R,5S,6R,12S,13R,15S,16R)-4,14-dioxaheptacyclo[10.8.1.12,7.03,5.013,15.017,21.011,22]docosa-1(21),7,9,11(22),17,19-hexaene-6,8,16,18-tetrol |
| Manual Xrefs | Databases |
|---|---|
| 78437331 | ChemSpider |