EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H14O10 |
| Net Charge | 0 |
| Average Mass | 402.311 |
| Monoisotopic Mass | 402.05870 |
| SMILES | COc1cc(C)c2c(c1C(=O)O)Oc1c(c(C)c(O)c3c1[C@@H](O)OC3=O)OC2=O |
| InChI | InChI=1S/C19H14O10/c1-5-4-7(26-3)9(16(21)22)14-8(5)17(23)28-13-6(2)12(20)10-11(15(13)27-14)19(25)29-18(10)24/h4,19-20,25H,1-3H3,(H,21,22)/t19-/m0/s1 |
| InChIKey | HIPOOOQGJTVSMG-IBGZPJMESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Relicina sydneyensis (ncbitaxon:299008) | - | DOI (10.1071/ch00121) |
| Roles Classification |
|---|
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Peristictic acid (CHEBI:207284) is a phthalate ester (CHEBI:35484) |
| IUPAC Name |
|---|
| 13,17-dihydroxy-5-methoxy-7,12-dimethyl-9,15-dioxo-2,10,16-trioxatetracyclo[9.7.0.03,8.014,18]octadeca-1(11),3(8),4,6,12,14(18)-hexaene-4-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 78435495 | ChemSpider |