EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H18O5 |
| Net Charge | 0 |
| Average Mass | 230.260 |
| Monoisotopic Mass | 230.11542 |
| SMILES | CC(CC(O)CC[C@H]1OC(=O)[C@@H]1C)OC=O |
| InChI | InChI=1S/C11H18O5/c1-7(15-6-12)5-9(13)3-4-10-8(2)11(14)16-10/h6-10,13H,3-5H2,1-2H3/t7?,8-,9?,10-/m1/s1 |
| InChIKey | QOJDJYDRXZTLLL-QLVNRRSVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies T1B1 (ncbitaxon:1285899) | - | DOI (10.1016/j.phytol.2013.08.007) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4alpha-(3-methyl-4-formyloxy-hexyl)-3alpha-methyl-2-oxetanone (CHEBI:207186) is a dicarboxylic acid (CHEBI:35692) |
| IUPAC Name |
|---|
| [4-hydroxy-6-[(2R,3R)-3-methyl-4-oxooxetan-2-yl]hexan-2-yl] ormate |
| Manual Xrefs | Databases |
|---|---|
| 78441466 | ChemSpider |